C20H24ClN3S — CID 45280504
2-chloro-10-[1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine (PubChem CID 45280504) has the molecular formula C20H24ClN3S and a molecular weight of 388.04 g/mol. Its IUPAC name is 2-chloro-10-[1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine.
| Compound Name | 2-chloro-10-[1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine |
|---|---|
| PubChem CID | 45280504 |
| Molecular Formula | C20H24ClN3S |
| Molecular Weight | 388.04 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-chloro-10-[1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine |
| SMILES | [2H]C1([2H])N(C)C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C([2H])([2H])C([2H])([2H])N2c3ccccc3Sc3ccc(Cl)cc32)C1([2H])[2H] |
| InChI | InChI=1S/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3/i4D2,9D2,10D2,11D2,12D2,13D2,14D2 |
| InChIKey | WIKYUJGCLQQFNW-NJORCCEASA-N |
| XLogP | 4.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |