C21H25ClN4S — CID 89080377
1-(2-chlorophenothiazin-10-yl)-N-methyl-N-[(4-methylpiperazin-1-yl)methyl]ethenamine (PubChem CID 89080377) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-N-methyl-N-[(4-methylpiperazin-1-yl)methyl]ethenamine.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-N-methyl-N-[(4-methylpiperazin-1-yl)methyl]ethenamine |
|---|---|
| PubChem CID | 89080377 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-N-methyl-N-[(4-methylpiperazin-1-yl)methyl]ethenamine |
| SMILES | C=C(N(C)CN1CCN(C)CC1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H25ClN4S/c1-16(24(3)15-25-12-10-23(2)11-13-25)26-18-6-4-5-7-20(18)27-21-9-8-17(22)14-19(21)26/h4-9,14H,1,10-13,15H2,2-3H3 |
| InChIKey | XLOJURDQQDXBQE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |