C25H25ClF3N2S+ — CID 16729206
(4-chlorophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium (PubChem CID 16729206) has the molecular formula C25H25ClF3N2S+ and a molecular weight of 478.00 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium.
| Compound Name | (4-chlorophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium |
|---|---|
| PubChem CID | 16729206 |
| Molecular Formula | C25H25ClF3N2S+ |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (4-chlorophenyl)methyl-dimethyl-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]azanium |
| SMILES | C[N+](C)(CCCN1c2ccccc2Sc2ccc(C(F)(F)F)cc21)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClF3N2S/c1-31(2,17-18-8-11-20(26)12-9-18)15-5-14-30-21-6-3-4-7-23(21)32-24-13-10-19(16-22(24)30)25(27,28)29/h3-4,6-13,16H,5,14-15,17H2,1-2H3/q+1 |
| InChIKey | MYKDUKIDPAMWRW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|