C37H44Br2Cl2N4S2 — CID 135395392
[3,7-bis(2-chlorophenothiazin-10-yl)-9-(dimethylazaniumyl)nonyl]-dimethylazanium dibromide (PubChem CID 135395392) has the molecular formula C37H44Br2Cl2N4S2 and a molecular weight of 839.64 g/mol. Its IUPAC name is [3,7-bis(2-chlorophenothiazin-10-yl)-9-(dimethylazaniumyl)nonyl]-dimethylazanium dibromide.
| Compound Name | [3,7-bis(2-chlorophenothiazin-10-yl)-9-(dimethylazaniumyl)nonyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 135395392 |
| Molecular Formula | C37H44Br2Cl2N4S2 |
| Molecular Weight | 839.64 g/mol |
| Exact Mass | 836.08 |
| IUPAC Name | [3,7-bis(2-chlorophenothiazin-10-yl)-9-(dimethylazaniumyl)nonyl]-dimethylazanium dibromide |
| SMILES | C[NH+](C)CCC(CCCC(CC[NH+](C)C)N1c2ccccc2Sc2ccc(Cl)cc21)N1c2ccccc2Sc2ccc(Cl)cc21.[Br-].[Br-] |
| InChI | InChI=1S/C37H42Cl2N4S2.2BrH/c1-40(2)22-20-28(42-30-12-5-7-14-34(30)44-36-18-16-26(38)24-32(36)42)10-9-11-29(21-23-41(3)4)43-31-13-6-8-15-35(31)45-37-19-17-27(39)25-33(37)43;;/h5-8,12-19,24-25,28-29H,9-11,20-23H2,1-4H3;2*1H |
| InChIKey | BTNLEPRIKDWCLL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.64 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |