C18H21ClN2OS — CID 4079548
1-(2-chlorophenothiazin-10-yl)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 4079548) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 4079548 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)CN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H21ClN2OS/c1-12(2)20-10-14(22)11-21-15-5-3-4-6-17(15)23-18-8-7-13(19)9-16(18)21/h3-9,12,14,20,22H,10-11H2,1-2H3 |
| InChIKey | MFFICZMPHYJGGZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |