C19H24N2O2S — CID 881872
(2S)-2-[[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]amino]butan-1-ol (PubChem CID 881872) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]amino]butan-1-ol.
| Compound Name | (2S)-2-[[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 881872 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]amino]butan-1-ol |
| SMILES | CC[C@@H](CO)NC[C@@H](O)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H24N2O2S/c1-2-14(13-22)20-11-15(23)12-21-16-7-3-5-9-18(16)24-19-10-6-4-8-17(19)21/h3-10,14-15,20,22-23H,2,11-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | GDAWASZFWNMWKN-LSDHHAIUSA-N |
| XLogP | 3.01 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|