C22H22ClN3O2S2 — CID 166592849
1-[[S-(4-chlorophenyl)-N-methylsulfonimidoyl]amino]-3-phenothiazin-10-ylpropan-2-ol (PubChem CID 166592849) has the molecular formula C22H22ClN3O2S2 and a molecular weight of 460.02 g/mol. Its IUPAC name is 1-[[S-(4-chlorophenyl)-N-methylsulfonimidoyl]amino]-3-phenothiazin-10-ylpropan-2-ol.
| Compound Name | 1-[[S-(4-chlorophenyl)-N-methylsulfonimidoyl]amino]-3-phenothiazin-10-ylpropan-2-ol |
|---|---|
| PubChem CID | 166592849 |
| Molecular Formula | C22H22ClN3O2S2 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 1-[[S-(4-chlorophenyl)-N-methylsulfonimidoyl]amino]-3-phenothiazin-10-ylpropan-2-ol |
| SMILES | CN=S(=O)(NCC(O)CN1c2ccccc2Sc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O2S2/c1-24-30(28,18-12-10-16(23)11-13-18)25-14-17(27)15-26-19-6-2-4-8-21(19)29-22-9-5-3-7-20(22)26/h2-13,17,27H,14-15H2,1H3,(H,24,25,28) |
| InChIKey | CVBSZEZZHVRMCF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|