C34H32Cl2N4O2S3 — CID 158961805
4-chloro-N-(2-phenothiazin-10-ylethyl)benzenesulfonamide;2-phenothiazin-10-ylethanamine;hydrochloride (PubChem CID 158961805) has the molecular formula C34H32Cl2N4O2S3 and a molecular weight of 695.76 g/mol. Its IUPAC name is 4-chloro-N-(2-phenothiazin-10-ylethyl)benzenesulfonamide;2-phenothiazin-10-ylethanamine;hydrochloride.
| Compound Name | 4-chloro-N-(2-phenothiazin-10-ylethyl)benzenesulfonamide;2-phenothiazin-10-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 158961805 |
| Molecular Formula | C34H32Cl2N4O2S3 |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 694.11 |
| IUPAC Name | 4-chloro-N-(2-phenothiazin-10-ylethyl)benzenesulfonamide;2-phenothiazin-10-ylethanamine;hydrochloride |
| SMILES | Cl.NCCN1c2ccccc2Sc2ccccc21.O=S(=O)(NCCN1c2ccccc2Sc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O2S2.C14H14N2S.ClH/c21-15-9-11-16(12-10-15)27(24,25)22-13-14-23-17-5-1-3-7-19(17)26-20-8-4-2-6-18(20)23;15-9-10-16-11-5-1-3-7-13(11)17-14-8-4-2-6-12(14)16;/h1-12,22H,13-14H2;1-8H,9-10,15H2;1H |
| InChIKey | CJZKKZFIBLOWMC-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|