C22H18ClNO2S2 — CID 71258516
4-chloro-N-(3-thioxanthen-9-ylidenepropyl)benzenesulfonamide (PubChem CID 71258516) has the molecular formula C22H18ClNO2S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 4-chloro-N-(3-thioxanthen-9-ylidenepropyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3-thioxanthen-9-ylidenepropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71258516 |
| Molecular Formula | C22H18ClNO2S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 4-chloro-N-(3-thioxanthen-9-ylidenepropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCC=C1c2ccccc2Sc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO2S2/c23-16-11-13-17(14-12-16)28(25,26)24-15-5-8-18-19-6-1-3-9-21(19)27-22-10-4-2-7-20(18)22/h1-4,6-14,24H,5,15H2 |
| InChIKey | VKYASNSABMYTEG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|