C18H20ClNO2S — CID 18921501
4-chloro-N-[3-(2,3-dihydro-1H-inden-2-yl)propyl]benzenesulfonamide (PubChem CID 18921501) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,3-dihydro-1H-inden-2-yl)propyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(2,3-dihydro-1H-inden-2-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18921501 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-chloro-N-[3-(2,3-dihydro-1H-inden-2-yl)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCC1Cc2ccccc2C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO2S/c19-17-7-9-18(10-8-17)23(21,22)20-11-3-4-14-12-15-5-1-2-6-16(15)13-14/h1-2,5-10,14,20H,3-4,11-13H2 |
| InChIKey | AOHQZEGMUFXRSH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|