C19H22Cl2N2S — CID 3064128
N-(2-chloroethyl)-1-(2-chlorophenothiazin-10-yl)-N-ethylpropan-2-amine (PubChem CID 3064128) has the molecular formula C19H22Cl2N2S and a molecular weight of 381.37 g/mol. Its IUPAC name is N-(2-chloroethyl)-1-(2-chlorophenothiazin-10-yl)-N-ethylpropan-2-amine.
| Compound Name | N-(2-chloroethyl)-1-(2-chlorophenothiazin-10-yl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 3064128 |
| Molecular Formula | C19H22Cl2N2S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(2-chloroethyl)-1-(2-chlorophenothiazin-10-yl)-N-ethylpropan-2-amine |
| SMILES | CCN(CCCl)C(C)CN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H22Cl2N2S/c1-3-22(11-10-20)14(2)13-23-16-6-4-5-7-18(16)24-19-9-8-15(21)12-17(19)23/h4-9,12,14H,3,10-11,13H2,1-2H3 |
| InChIKey | LTDVECDBEJWJSS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|