C19H23ClN2S — CID 4082930
2-(2-chlorophenothiazin-10-yl)-N,N-diethylpropan-1-amine (PubChem CID 4082930) has the molecular formula C19H23ClN2S and a molecular weight of 346.93 g/mol. Its IUPAC name is 2-(2-chlorophenothiazin-10-yl)-N,N-diethylpropan-1-amine.
| Compound Name | 2-(2-chlorophenothiazin-10-yl)-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 4082930 |
| Molecular Formula | C19H23ClN2S |
| Molecular Weight | 346.93 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-(2-chlorophenothiazin-10-yl)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CC(C)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H23ClN2S/c1-4-21(5-2)13-14(3)22-16-8-6-7-9-18(16)23-19-11-10-15(20)12-17(19)22/h6-12,14H,4-5,13H2,1-3H3 |
| InChIKey | OSRHRKZKAYRCMF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |