C18H22ClN2O2S2+ — CID 57107695
[3-(2-chlorophenothiazin-10-yl)-3-sulfinopropyl]-trimethylazanium (PubChem CID 57107695) has the molecular formula C18H22ClN2O2S2+ and a molecular weight of 397.97 g/mol. Its IUPAC name is [3-(2-chlorophenothiazin-10-yl)-3-sulfinopropyl]-trimethylazanium.
| Compound Name | [3-(2-chlorophenothiazin-10-yl)-3-sulfinopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 57107695 |
| Molecular Formula | C18H22ClN2O2S2+ |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [3-(2-chlorophenothiazin-10-yl)-3-sulfinopropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCC(N1c2ccccc2Sc2ccc(Cl)cc21)S(=O)O |
| InChI | InChI=1S/C18H21ClN2O2S2/c1-21(2,3)11-10-18(25(22)23)20-14-6-4-5-7-16(14)24-17-9-8-13(19)12-15(17)20/h4-9,12,18H,10-11H2,1-3H3/p+1 |
| InChIKey | LJEGGGQOWQLQJT-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|