C26H37N3OS — CID 139682412
2-[10-[1-(diethylamino)propan-2-yl]-1-(2-methylbutyl)phenothiazin-2-yl]acetamide (PubChem CID 139682412) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is 2-[10-[1-(diethylamino)propan-2-yl]-1-(2-methylbutyl)phenothiazin-2-yl]acetamide.
| Compound Name | 2-[10-[1-(diethylamino)propan-2-yl]-1-(2-methylbutyl)phenothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 139682412 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[10-[1-(diethylamino)propan-2-yl]-1-(2-methylbutyl)phenothiazin-2-yl]acetamide |
| SMILES | CCC(C)Cc1c(CC(N)=O)ccc2c1N(C(C)CN(CC)CC)c1ccccc1S2 |
| InChI | InChI=1S/C26H37N3OS/c1-6-18(4)15-21-20(16-25(27)30)13-14-24-26(21)29(19(5)17-28(7-2)8-3)22-11-9-10-12-23(22)31-24/h9-14,18-19H,6-8,15-17H2,1-5H3,(H2,27,30) |
| InChIKey | LXFMIWJNVDGGBI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |