C26H35N3S2 — CID 142625483
1-(3-methylbutyl)-10-(1-piperidin-1-ylpropan-2-yl)phenothiazine-2-carbothioamide (PubChem CID 142625483) has the molecular formula C26H35N3S2 and a molecular weight of 453.72 g/mol. Its IUPAC name is 1-(3-methylbutyl)-10-(1-piperidin-1-ylpropan-2-yl)phenothiazine-2-carbothioamide.
| Compound Name | 1-(3-methylbutyl)-10-(1-piperidin-1-ylpropan-2-yl)phenothiazine-2-carbothioamide |
|---|---|
| PubChem CID | 142625483 |
| Molecular Formula | C26H35N3S2 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-(3-methylbutyl)-10-(1-piperidin-1-ylpropan-2-yl)phenothiazine-2-carbothioamide |
| SMILES | CC(C)CCc1c(C(N)=S)ccc2c1N(C(C)CN1CCCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C26H35N3S2/c1-18(2)11-12-20-21(26(27)30)13-14-24-25(20)29(22-9-5-6-10-23(22)31-24)19(3)17-28-15-7-4-8-16-28/h5-6,9-10,13-14,18-19H,4,7-8,11-12,15-17H2,1-3H3,(H2,27,30) |
| InChIKey | BKZZVVRQMOFXAN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|