C22H28ClN3OS — CID 19860968
ethyl 10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboximidate;hydrochloride (PubChem CID 19860968) has the molecular formula C22H28ClN3OS and a molecular weight of 418.01 g/mol. Its IUPAC name is ethyl 10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboximidate;hydrochloride.
| Compound Name | ethyl 10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboximidate;hydrochloride |
|---|---|
| PubChem CID | 19860968 |
| Molecular Formula | C22H28ClN3OS |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | ethyl 10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCC)c1ccc2c(c1)N(C(C)CN1CCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H27N3OS.ClH/c1-3-26-22(23)17-10-11-21-19(14-17)25(16(2)15-24-12-6-7-13-24)18-8-4-5-9-20(18)27-21;/h4-5,8-11,14,16,23H,3,6-7,12-13,15H2,1-2H3;1H/b23-22-; |
| InChIKey | XRWBRSJAIHNSBY-YJACDMIVSA-N |
| XLogP | 5.56 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|