C22H28ClN3OS — CID 19860965
N-ethyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide;hydrochloride (PubChem CID 19860965) has the molecular formula C22H28ClN3OS and a molecular weight of 418.01 g/mol. Its IUPAC name is N-ethyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide;hydrochloride.
| Compound Name | N-ethyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 19860965 |
| Molecular Formula | C22H28ClN3OS |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-ethyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc2c(c1)N(C(C)CN1CCCC1)c1ccccc1S2.Cl |
| InChI | InChI=1S/C22H27N3OS.ClH/c1-3-23-22(26)17-10-11-21-19(14-17)25(16(2)15-24-12-6-7-13-24)18-8-4-5-9-20(18)27-21;/h4-5,8-11,14,16H,3,6-7,12-13,15H2,1-2H3,(H,23,26);1H |
| InChIKey | SNJNTPSNKOIINK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |