C25H33N3OS — CID 67927885
N-[(2R)-2-methylbutyl]-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide (PubChem CID 67927885) has the molecular formula C25H33N3OS and a molecular weight of 423.63 g/mol. Its IUPAC name is N-[(2R)-2-methylbutyl]-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide.
| Compound Name | N-[(2R)-2-methylbutyl]-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 67927885 |
| Molecular Formula | C25H33N3OS |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[(2R)-2-methylbutyl]-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
| SMILES | CC[C@@H](C)CNC(=O)c1ccc2c(c1)N(C(C)CN1CCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C25H33N3OS/c1-4-18(2)16-26-25(29)20-11-12-24-22(15-20)28(19(3)17-27-13-7-8-14-27)21-9-5-6-10-23(21)30-24/h5-6,9-12,15,18-19H,4,7-8,13-14,16-17H2,1-3H3,(H,26,29)/t18-,19?/m1/s1 |
| InChIKey | DKSVKXSFNRRRDA-MRTLOADZSA-N |
| XLogP | 5.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |