C29H35N3O5S — CID 67922628
but-2-enedioic acid;N-(cyclobutylmethyl)-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide (PubChem CID 67922628) has the molecular formula C29H35N3O5S and a molecular weight of 537.68 g/mol. Its IUPAC name is but-2-enedioic acid;N-(cyclobutylmethyl)-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide.
| Compound Name | but-2-enedioic acid;N-(cyclobutylmethyl)-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 67922628 |
| Molecular Formula | C29H35N3O5S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | but-2-enedioic acid;N-(cyclobutylmethyl)-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
| SMILES | CC(CN1CCCC1)N1c2ccccc2Sc2ccc(C(=O)NCC3CCC3)cc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C25H31N3OS.C4H4O4/c1-18(17-27-13-4-5-14-27)28-21-9-2-3-10-23(21)30-24-12-11-20(15-22(24)28)25(29)26-16-19-7-6-8-19;5-3(6)1-2-4(7)8/h2-3,9-12,15,18-19H,4-8,13-14,16-17H2,1H3,(H,26,29);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RLXRDZGYIJFYCG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|