C23H29N3OS — CID 57299021
1-propyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide (PubChem CID 57299021) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-propyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide.
| Compound Name | 1-propyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 57299021 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-propyl-10-(1-pyrrolidin-1-ylpropan-2-yl)phenothiazine-2-carboxamide |
| SMILES | CCCc1c(C(N)=O)ccc2c1N(C(C)CN1CCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C23H29N3OS/c1-3-8-17-18(23(24)27)11-12-21-22(17)26(16(2)15-25-13-6-7-14-25)19-9-4-5-10-20(19)28-21/h4-5,9-12,16H,3,6-8,13-15H2,1-2H3,(H2,24,27) |
| InChIKey | UCNGUHKFWCQURS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |