C20H27ClN4S — CID 70356780
10-[(2R)-1-(diethylamino)propan-2-yl]phenothiazine-2-carboximidamide;hydrochloride (PubChem CID 70356780) has the molecular formula C20H27ClN4S and a molecular weight of 390.98 g/mol. Its IUPAC name is 10-[(2R)-1-(diethylamino)propan-2-yl]phenothiazine-2-carboximidamide;hydrochloride.
| Compound Name | 10-[(2R)-1-(diethylamino)propan-2-yl]phenothiazine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 70356780 |
| Molecular Formula | C20H27ClN4S |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 10-[(2R)-1-(diethylamino)propan-2-yl]phenothiazine-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2c(c1)N([C@H](C)CN(CC)CC)c1ccccc1S2 |
| InChI | InChI=1S/C20H26N4S.ClH/c1-4-23(5-2)13-14(3)24-16-8-6-7-9-18(16)25-19-11-10-15(20(21)22)12-17(19)24;/h6-12,14H,4-5,13H2,1-3H3,(H3,21,22);1H/t14-;/m1./s1 |
| InChIKey | QJUZRKVFIOSYAS-PFEQFJNWSA-N |
| XLogP | 4.73 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|