C19H20NNaO5S2 — CID 23686165
sodium 3-(2-butanoylphenothiazin-10-yl)propyl sulfate (PubChem CID 23686165) has the molecular formula C19H20NNaO5S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is sodium 3-(2-butanoylphenothiazin-10-yl)propyl sulfate.
| Compound Name | sodium 3-(2-butanoylphenothiazin-10-yl)propyl sulfate |
|---|---|
| PubChem CID | 23686165 |
| Molecular Formula | C19H20NNaO5S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | sodium 3-(2-butanoylphenothiazin-10-yl)propyl sulfate |
| SMILES | CCCC(=O)c1ccc2c(c1)N(CCCOS(=O)(=O)[O-])c1ccccc1S2.[Na+] |
| InChI | InChI=1S/C19H21NO5S2.Na/c1-2-6-17(21)14-9-10-19-16(13-14)20(11-5-12-25-27(22,23)24)15-7-3-4-8-18(15)26-19;/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | HGTUPYCRTXQCCF-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|