C44H52N2O6S4 — CID 90450697
ditert-butyl 1,4-bis[5-(4-hexylthiophen-2-yl)thiophen-2-yl]-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 90450697) has the molecular formula C44H52N2O6S4 and a molecular weight of 833.18 g/mol. Its IUPAC name is ditert-butyl 1,4-bis[5-(4-hexylthiophen-2-yl)thiophen-2-yl]-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | ditert-butyl 1,4-bis[5-(4-hexylthiophen-2-yl)thiophen-2-yl]-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 90450697 |
| Molecular Formula | C44H52N2O6S4 |
| Molecular Weight | 833.18 g/mol |
| Exact Mass | 832.27 |
| IUPAC Name | ditert-butyl 1,4-bis[5-(4-hexylthiophen-2-yl)thiophen-2-yl]-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CCCCCCc1csc(-c2ccc(C3=C4C(=O)N(C(=O)OC(C)(C)C)C(c5ccc(-c6cc(CCCCCC)cs6)s5)=C4C(=O)N3C(=O)OC(C)(C)C)s2)c1 |
| InChI | InChI=1S/C44H52N2O6S4/c1-9-11-13-15-17-27-23-33(53-25-27)29-19-21-31(55-29)37-35-36(40(48)45(37)41(49)51-43(3,4)5)38(46(39(35)47)42(50)52-44(6,7)8)32-22-20-30(56-32)34-24-28(26-54-34)18-16-14-12-10-2/h19-26H,9-18H2,1-8H3 |
| InChIKey | DAOYZOBPMVHWOC-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.18 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|