C17H11F6NS3 — CID 118595869
ethyl 3,7-bis(trifluoromethyl)phenothiazine-10-carbodithioate (PubChem CID 118595869) has the molecular formula C17H11F6NS3 and a molecular weight of 439.47 g/mol. Its IUPAC name is ethyl 3,7-bis(trifluoromethyl)phenothiazine-10-carbodithioate.
| Compound Name | ethyl 3,7-bis(trifluoromethyl)phenothiazine-10-carbodithioate |
|---|---|
| PubChem CID | 118595869 |
| Molecular Formula | C17H11F6NS3 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | ethyl 3,7-bis(trifluoromethyl)phenothiazine-10-carbodithioate |
| SMILES | CCSC(=S)N1c2ccc(C(F)(F)F)cc2Sc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H11F6NS3/c1-2-26-15(25)24-11-5-3-9(16(18,19)20)7-13(11)27-14-8-10(17(21,22)23)4-6-12(14)24/h3-8H,2H2,1H3 |
| InChIKey | DCLBXUPRHLHHLH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|