C15H18ClF3N2O3S — CID 41447130
(3R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 41447130) has the molecular formula C15H18ClF3N2O3S and a molecular weight of 398.83 g/mol. Its IUPAC name is (3R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41447130 |
| Molecular Formula | C15H18ClF3N2O3S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (3R)-N-[2-chloro-5-(trifluoromethyl)phenyl]-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)Nc2cc(C(F)(F)F)ccc2Cl)C1 |
| InChI | InChI=1S/C15H18ClF3N2O3S/c1-2-25(23,24)21-7-3-4-10(9-21)14(22)20-13-8-11(15(17,18)19)5-6-12(13)16/h5-6,8,10H,2-4,7,9H2,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | JYTCBFJNSKTELA-SNVBAGLBSA-N |
| XLogP | 3.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |