C11H15ClN2O2 — CID 106683666
(2-chlorofuran-3-yl)-(2,5-dimethylpiperazin-1-yl)methanone (PubChem CID 106683666) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(2,5-dimethylpiperazin-1-yl)methanone.
| Compound Name | (2-chlorofuran-3-yl)-(2,5-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 106683666 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (2-chlorofuran-3-yl)-(2,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccoc2Cl)C(C)CN1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-7-6-14(8(2)5-13-7)11(15)9-3-4-16-10(9)12/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | CRFIZWMBCUWZOI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |