C13H16FIN2O — CID 113363045
(2,5-dimethylpiperazin-1-yl)-(4-fluoro-2-iodophenyl)methanone (PubChem CID 113363045) has the molecular formula C13H16FIN2O and a molecular weight of 362.19 g/mol. Its IUPAC name is (2,5-dimethylpiperazin-1-yl)-(4-fluoro-2-iodophenyl)methanone.
| Compound Name | (2,5-dimethylpiperazin-1-yl)-(4-fluoro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 113363045 |
| Molecular Formula | C13H16FIN2O |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2,5-dimethylpiperazin-1-yl)-(4-fluoro-2-iodophenyl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(F)cc2I)C(C)CN1 |
| InChI | InChI=1S/C13H16FIN2O/c1-8-7-17(9(2)6-16-8)13(18)11-4-3-10(14)5-12(11)15/h3-5,8-9,16H,6-7H2,1-2H3 |
| InChIKey | QPJFVHXQDJKAAZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|