C13H18N2O2 — CID 64979494
(2,5-dimethylpiperazin-1-yl)-(3-hydroxyphenyl)methanone (PubChem CID 64979494) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2,5-dimethylpiperazin-1-yl)-(3-hydroxyphenyl)methanone.
| Compound Name | (2,5-dimethylpiperazin-1-yl)-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 64979494 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2,5-dimethylpiperazin-1-yl)-(3-hydroxyphenyl)methanone |
| SMILES | CC1CN(C(=O)c2cccc(O)c2)C(C)CN1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-8-15(10(2)7-14-9)13(17)11-4-3-5-12(16)6-11/h3-6,9-10,14,16H,7-8H2,1-2H3 |
| InChIKey | GNDRWKVFUJDTFU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |