C12H12N2O6 — CID 107433324
1-(2,4-dihydroxybenzoyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107433324) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-(2,4-dihydroxybenzoyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(2,4-dihydroxybenzoyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107433324 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(2,4-dihydroxybenzoyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)c2ccc(O)cc2O)C(C(=O)O)CN1 |
| InChI | InChI=1S/C12H12N2O6/c15-6-1-2-7(9(16)3-6)11(18)14-5-10(17)13-4-8(14)12(19)20/h1-3,8,15-16H,4-5H2,(H,13,17)(H,19,20) |
| InChIKey | QJPRFFRVVRCIJG-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |