C10H12N2O4 — CID 61151805
(2S)-4-hydroxy-1-(1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 61151805) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-(1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61151805 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2S)-4-hydroxy-1-(1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C10H12N2O4/c13-6-4-8(10(15)16)12(5-6)9(14)7-2-1-3-11-7/h1-3,6,8,11,13H,4-5H2,(H,15,16)/t6?,8-/m0/s1 |
| InChIKey | VSFLZLSJYDRSSB-XDKWHASVSA-N |
| XLogP | -0.33 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |