C13H15Cl2N3O3 — CID 107191893
[4-(aminomethyl)piperidin-1-yl]-(2,3-dichloro-5-nitrophenyl)methanone (PubChem CID 107191893) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is [4-(aminomethyl)piperidin-1-yl]-(2,3-dichloro-5-nitrophenyl)methanone.
| Compound Name | [4-(aminomethyl)piperidin-1-yl]-(2,3-dichloro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 107191893 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [4-(aminomethyl)piperidin-1-yl]-(2,3-dichloro-5-nitrophenyl)methanone |
| SMILES | NCC1CCN(C(=O)c2cc([N+](=O)[O-])cc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-11-6-9(18(20)21)5-10(12(11)15)13(19)17-3-1-8(7-16)2-4-17/h5-6,8H,1-4,7,16H2 |
| InChIKey | HXEPTIZPVKRJBN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|