C27H25N3O6S — CID 1418939
2-[3-benzoyl-4-(diethylamino)-1,1-dioxo-1lambda6,2-benzothiazin-2-yl]-1-(4-nitrophenyl)ethanone (PubChem CID 1418939) has the molecular formula C27H25N3O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[3-benzoyl-4-(diethylamino)-1,1-dioxo-1lambda6,2-benzothiazin-2-yl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[3-benzoyl-4-(diethylamino)-1,1-dioxo-1lambda6,2-benzothiazin-2-yl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 1418939 |
| Molecular Formula | C27H25N3O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 2-[3-benzoyl-4-(diethylamino)-1,1-dioxo-1lambda6,2-benzothiazin-2-yl]-1-(4-nitrophenyl)ethanone |
| SMILES | CCN(CC)C1=C(C(=O)c2ccccc2)N(CC(=O)c2ccc([N+](=O)[O-])cc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C27H25N3O6S/c1-3-28(4-2)25-22-12-8-9-13-24(22)37(35,36)29(26(25)27(32)20-10-6-5-7-11-20)18-23(31)19-14-16-21(17-15-19)30(33)34/h5-17H,3-4,18H2,1-2H3 |
| InChIKey | SGEBLYINOWRGPQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|