C15H15N3O5S — CID 54707114
2-[4-hydroxy-3-(morpholine-4-carbonyl)-1,1-dioxo-1λ6,2-benzothiazin-2-yl]acetonitrile (PubChem CID 54707114) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(morpholine-4-carbonyl)-1,1-dioxo-1λ6,2-benzothiazin-2-yl]acetonitrile.
| Compound Name | 2-[4-hydroxy-3-(morpholine-4-carbonyl)-1,1-dioxo-1λ6,2-benzothiazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 54707114 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[4-hydroxy-3-(morpholine-4-carbonyl)-1,1-dioxo-1λ6,2-benzothiazin-2-yl]acetonitrile |
| SMILES | N#CCN1C(C(=O)N2CCOCC2)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H15N3O5S/c16-5-6-18-13(15(20)17-7-9-23-10-8-17)14(19)11-3-1-2-4-12(11)24(18,21)22/h1-4,19H,6-10H2 |
| InChIKey | DZTMFMVJUWFQFP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|