C17H12N2O4S — CID 11772167
methyl 2-(2,4-dioxo-3-phenyl-5-sulfanylideneimidazolidin-1-yl)benzoate (PubChem CID 11772167) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is methyl 2-(2,4-dioxo-3-phenyl-5-sulfanylideneimidazolidin-1-yl)benzoate.
| Compound Name | methyl 2-(2,4-dioxo-3-phenyl-5-sulfanylideneimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 11772167 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | methyl 2-(2,4-dioxo-3-phenyl-5-sulfanylideneimidazolidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)N(c2ccccc2)C(=O)C1=S |
| InChI | InChI=1S/C17H12N2O4S/c1-23-16(21)12-9-5-6-10-13(12)19-15(24)14(20)18(17(19)22)11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | PVOBBEMPAZUVSQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|