C18H15N3O3S — CID 11428152
methyl 2-[4-imino-3-(4-methylphenyl)-2-oxo-5-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 11428152) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 2-[4-imino-3-(4-methylphenyl)-2-oxo-5-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | methyl 2-[4-imino-3-(4-methylphenyl)-2-oxo-5-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 11428152 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 2-[4-imino-3-(4-methylphenyl)-2-oxo-5-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | [H]/N=C1\C(=S)N(c2ccccc2C(=O)OC)C(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c1-11-7-9-12(10-8-11)20-15(19)16(25)21(18(20)23)14-6-4-3-5-13(14)17(22)24-2/h3-10,19H,1-2H3/b19-15+ |
| InChIKey | AJWISPKHQSTSBX-XDJHFCHBSA-N |
| XLogP | 3.53 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|