C19H16N2O4S — CID 11245585
methyl 2-[3-(2,6-dimethylphenyl)-2,4-dioxo-5-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 11245585) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl 2-[3-(2,6-dimethylphenyl)-2,4-dioxo-5-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | methyl 2-[3-(2,6-dimethylphenyl)-2,4-dioxo-5-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 11245585 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | methyl 2-[3-(2,6-dimethylphenyl)-2,4-dioxo-5-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)N(c2c(C)cccc2C)C(=O)C1=S |
| InChI | InChI=1S/C19H16N2O4S/c1-11-7-6-8-12(2)15(11)21-16(22)17(26)20(19(21)24)14-10-5-4-9-13(14)18(23)25-3/h4-10H,1-3H3 |
| InChIKey | KHEMMUDZZJMFNE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|