methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate

C15H15NO4 — CID 4967746

IUPACmethyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate
SMILESCCC=C1CC(=O)N(c2ccccc2C(=O)OC)C1=O
InChIInChI=1S/C15H15NO4/c1-3-6-10-9-13(17)16(14(10)18)12-8-5-4-7-11(12)15(19)20-2/h4-8H,3,9H2,1-2H3
InChIKeyVRDABMQAIBGYIP-UHFFFAOYSA-N
MW273.29 g/mol
LogP2.07
Rot. Bonds3

About methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate

methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate (PubChem CID 4967746) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate
PubChem CID4967746
Molecular FormulaC15H15NO4
Molecular Weight273.29 g/mol
Exact Mass273.10
IUPAC Namemethyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate
SMILESCCC=C1CC(=O)N(c2ccccc2C(=O)OC)C1=O
InChIInChI=1S/C15H15NO4/c1-3-6-10-9-13(17)16(14(10)18)12-8-5-4-7-11(12)15(19)20-2/h4-8H,3,9H2,1-2H3
InChIKeyVRDABMQAIBGYIP-UHFFFAOYSA-N
XLogP2.07
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 52.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate?
The IUPAC name of methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate (CID 4967746) is methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate.
What is the SMILES notation for methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate?
The canonical SMILES for methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate is CCC=C1CC(=O)N(c2ccccc2C(=O)OC)C1=O.
What is the InChIKey of methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate?
The InChIKey is VRDABMQAIBGYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-3-6-10-9-13(17)16(14(10)18)12-8-5-4-7-11(12)15(19)20-2/h4-8H,3,9H2,1-2H3.
What are the key properties of methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate?
methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate has a molecular weight of 273.29 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dioxo-3-propylidenepyrrolidin-1-yl)benzoate is sourced from PubChem (CID 4967746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).