C18H20ClN3O4 — CID 1180128
methyl 2-[3-chloro-4-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate (PubChem CID 1180128) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[3-chloro-4-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 1180128 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl 2-[3-chloro-4-(4-ethylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate |
| SMILES | CCN1CCN(C2=C(Cl)C(=O)N(c3ccccc3C(=O)OC)C2=O)CC1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-3-20-8-10-21(11-9-20)15-14(19)16(23)22(17(15)24)13-7-5-4-6-12(13)18(25)26-2/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | PKTLRLASPYURQP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|