C17H15NO4S — CID 802741
(2S)-4-hydroxy-3-methylsulfonyl-1,2-diphenyl-2H-pyrrol-5-one (PubChem CID 802741) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is (2S)-4-hydroxy-3-methylsulfonyl-1,2-diphenyl-2H-pyrrol-5-one.
| Compound Name | (2S)-4-hydroxy-3-methylsulfonyl-1,2-diphenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 802741 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2S)-4-hydroxy-3-methylsulfonyl-1,2-diphenyl-2H-pyrrol-5-one |
| SMILES | CS(=O)(=O)C1=C(O)C(=O)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO4S/c1-23(21,22)16-14(12-8-4-2-5-9-12)18(17(20)15(16)19)13-10-6-3-7-11-13/h2-11,14,19H,1H3/t14-/m0/s1 |
| InChIKey | XFSJRYNTZUUCHM-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |