C22H15BrFNO4S — CID 95052352
(2R)-3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 95052352) has the molecular formula C22H15BrFNO4S and a molecular weight of 488.33 g/mol. Its IUPAC name is (2R)-3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | (2R)-3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 95052352 |
| Molecular Formula | C22H15BrFNO4S |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | (2R)-3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | O=C1C(O)=C(S(=O)(=O)c2ccccc2)[C@@H](c2ccc(F)cc2)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H15BrFNO4S/c23-15-8-12-17(13-9-15)25-19(14-6-10-16(24)11-7-14)21(20(26)22(25)27)30(28,29)18-4-2-1-3-5-18/h1-13,19,26H/t19-/m1/s1 |
| InChIKey | WVXJUBZNPOBCMB-LJQANCHMSA-N |
| XLogP | 4.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |