C24H18FNO6S — CID 53017618
methyl 4-[3-(benzenesulfonyl)-1-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate (PubChem CID 53017618) has the molecular formula C24H18FNO6S and a molecular weight of 467.47 g/mol. Its IUPAC name is methyl 4-[3-(benzenesulfonyl)-1-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[3-(benzenesulfonyl)-1-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 53017618 |
| Molecular Formula | C24H18FNO6S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | methyl 4-[3-(benzenesulfonyl)-1-(3-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(S(=O)(=O)c3ccccc3)=C(O)C(=O)N2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H18FNO6S/c1-32-24(29)16-12-10-15(11-13-16)20-22(33(30,31)19-8-3-2-4-9-19)21(27)23(28)26(20)18-7-5-6-17(25)14-18/h2-14,20,27H,1H3 |
| InChIKey | VTZBTVDKZHITNR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |