C24H20BrNO4S — CID 53017674
3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-ethylphenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 53017674) has the molecular formula C24H20BrNO4S and a molecular weight of 498.40 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-ethylphenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-ethylphenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 53017674 |
| Molecular Formula | C24H20BrNO4S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(4-bromophenyl)-2-(4-ethylphenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCc1ccc(C2C(S(=O)(=O)c3ccccc3)=C(O)C(=O)N2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20BrNO4S/c1-2-16-8-10-17(11-9-16)21-23(31(29,30)20-6-4-3-5-7-20)22(27)24(28)26(21)19-14-12-18(25)13-15-19/h3-15,21,27H,2H2,1H3 |
| InChIKey | SMQXDEDUWBAPGZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |