C19H24N2O4 — CID 8822607
ethyl (4R)-1,3,6-trimethyl-2-oxo-4-(3-prop-2-enoxyphenyl)-4H-pyrimidine-5-carboxylate (PubChem CID 8822607) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl (4R)-1,3,6-trimethyl-2-oxo-4-(3-prop-2-enoxyphenyl)-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-1,3,6-trimethyl-2-oxo-4-(3-prop-2-enoxyphenyl)-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8822607 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl (4R)-1,3,6-trimethyl-2-oxo-4-(3-prop-2-enoxyphenyl)-4H-pyrimidine-5-carboxylate |
| SMILES | C=CCOc1cccc([C@@H]2C(C(=O)OCC)=C(C)N(C)C(=O)N2C)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-6-11-25-15-10-8-9-14(12-15)17-16(18(22)24-7-2)13(3)20(4)19(23)21(17)5/h6,8-10,12,17H,1,7,11H2,2-5H3/t17-/m1/s1 |
| InChIKey | IKKPULKPLCNILA-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|