C30H25NO6 — CID 18857966
ethyl 4-[7-methyl-3,9-dioxo-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18857966) has the molecular formula C30H25NO6 and a molecular weight of 495.53 g/mol. Its IUPAC name is ethyl 4-[7-methyl-3,9-dioxo-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-methyl-3,9-dioxo-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18857966 |
| Molecular Formula | C30H25NO6 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | ethyl 4-[7-methyl-3,9-dioxo-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | C=CCOc1cccc(C2c3c(oc4ccc(C)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)c1 |
| InChI | InChI=1S/C30H25NO6/c1-4-15-36-22-8-6-7-20(17-22)26-25-27(32)23-16-18(3)9-14-24(23)37-28(25)29(33)31(26)21-12-10-19(11-13-21)30(34)35-5-2/h4,6-14,16-17,26H,1,5,15H2,2-3H3 |
| InChIKey | JJHFPNCRGZGJGI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|