C28H23NO4 — CID 18856951
6,7-dimethyl-2-phenyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18856951) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 6,7-dimethyl-2-phenyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 6,7-dimethyl-2-phenyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18856951 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 6,7-dimethyl-2-phenyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2ccccc2)c1 |
| InChI | InChI=1S/C28H23NO4/c1-4-13-32-21-12-8-9-19(16-21)25-24-26(30)22-14-17(2)18(3)15-23(22)33-27(24)28(31)29(25)20-10-6-5-7-11-20/h4-12,14-16,25H,1,13H2,2-3H3 |
| InChIKey | RJFLVSFMEZIYIT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|