C30H27NO5 — CID 18810927
2-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810927) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810927 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2Cc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C30H27NO5/c1-5-13-35-23-8-6-7-21(16-23)27-26-28(32)24-14-18(2)19(3)15-25(24)36-29(26)30(33)31(27)17-20-9-11-22(34-4)12-10-20/h5-12,14-16,27H,1,13,17H2,2-4H3 |
| InChIKey | JGNYORSCDZOSRS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|