C15H19NO5 — CID 10402128
benzyl (2S,3R)-1-acetyl-3-[(1S)-1-hydroxy-2-methoxyethyl]aziridine-2-carboxylate (PubChem CID 10402128) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is benzyl (2S,3R)-1-acetyl-3-[(1S)-1-hydroxy-2-methoxyethyl]aziridine-2-carboxylate.
| Compound Name | benzyl (2S,3R)-1-acetyl-3-[(1S)-1-hydroxy-2-methoxyethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10402128 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | benzyl (2S,3R)-1-acetyl-3-[(1S)-1-hydroxy-2-methoxyethyl]aziridine-2-carboxylate |
| SMILES | COC[C@@H](O)[C@H]1[C@@H](C(=O)OCc2ccccc2)N1C(C)=O |
| InChI | InChI=1S/C15H19NO5/c1-10(17)16-13(12(18)9-20-2)14(16)15(19)21-8-11-6-4-3-5-7-11/h3-7,12-14,18H,8-9H2,1-2H3/t12-,13+,14+,16?/m1/s1 |
| InChIKey | XCHTYKOSIRECLK-JLCDXLGXSA-N |
| XLogP | 0.34 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|