C21H22O6 — CID 142525192
2-(1-hydroxy-2-methoxyethyl)-3,4-bis(phenylmethoxy)-2H-furan-5-one (PubChem CID 142525192) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methoxyethyl)-3,4-bis(phenylmethoxy)-2H-furan-5-one.
| Compound Name | 2-(1-hydroxy-2-methoxyethyl)-3,4-bis(phenylmethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 142525192 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(1-hydroxy-2-methoxyethyl)-3,4-bis(phenylmethoxy)-2H-furan-5-one |
| SMILES | COCC(O)C1OC(=O)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C21H22O6/c1-24-14-17(22)18-19(25-12-15-8-4-2-5-9-15)20(21(23)27-18)26-13-16-10-6-3-7-11-16/h2-11,17-18,22H,12-14H2,1H3 |
| InChIKey | ROPYERWBPWEXQT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |