C22H25O11P — CID 71262036
[(1S)-1-[(2R)-3,4-bis[(4-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] dihydrogen phosphate (PubChem CID 71262036) has the molecular formula C22H25O11P and a molecular weight of 496.41 g/mol. Its IUPAC name is [(1S)-1-[(2R)-3,4-bis[(4-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] dihydrogen phosphate.
| Compound Name | [(1S)-1-[(2R)-3,4-bis[(4-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71262036 |
| Molecular Formula | C22H25O11P |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [(1S)-1-[(2R)-3,4-bis[(4-methoxyphenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] dihydrogen phosphate |
| SMILES | COc1ccc(COC2=C(OCc3ccc(OC)cc3)[C@@H]([C@H](CO)OP(=O)(O)O)OC2=O)cc1 |
| InChI | InChI=1S/C22H25O11P/c1-28-16-7-3-14(4-8-16)12-30-20-19(18(11-23)33-34(25,26)27)32-22(24)21(20)31-13-15-5-9-17(29-2)10-6-15/h3-10,18-19,23H,11-13H2,1-2H3,(H2,25,26,27)/t18-,19+/m0/s1 |
| InChIKey | DCFHQEVEGFEKAN-RBUKOAKNSA-N |
| XLogP | 2.04 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|