C22H29N2O9P — CID 144525890
2-(2-hydroxyethyl)-3,4-bis[[4-(methylamino)phenyl]methoxy]-2H-furan-5-one;phosphoric acid (PubChem CID 144525890) has the molecular formula C22H29N2O9P and a molecular weight of 496.45 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-3,4-bis[[4-(methylamino)phenyl]methoxy]-2H-furan-5-one;phosphoric acid.
| Compound Name | 2-(2-hydroxyethyl)-3,4-bis[[4-(methylamino)phenyl]methoxy]-2H-furan-5-one;phosphoric acid |
|---|---|
| PubChem CID | 144525890 |
| Molecular Formula | C22H29N2O9P |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-(2-hydroxyethyl)-3,4-bis[[4-(methylamino)phenyl]methoxy]-2H-furan-5-one;phosphoric acid |
| SMILES | CNc1ccc(COC2=C(OCc3ccc(NC)cc3)C(CCO)OC2=O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C22H26N2O5.H3O4P/c1-23-17-7-3-15(4-8-17)13-27-20-19(11-12-25)29-22(26)21(20)28-14-16-5-9-18(24-2)10-6-16;1-5(2,3)4/h3-10,19,23-25H,11-14H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | BECPVZPTJXLJSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|